C20H22N4O4 — CID 9064390
[(1S)-1-(3-nitrophenyl)ethyl] 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 9064390) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is [(1S)-1-(3-nitrophenyl)ethyl] 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | [(1S)-1-(3-nitrophenyl)ethyl] 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 9064390 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [(1S)-1-(3-nitrophenyl)ethyl] 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1cc2nc(C)c(CCC(=O)O[C@@H](C)c3cccc([N+](=O)[O-])c3)c(C)n2n1 |
| InChI | InChI=1S/C20H22N4O4/c1-12-10-19-21-13(2)18(14(3)23(19)22-12)8-9-20(25)28-15(4)16-6-5-7-17(11-16)24(26)27/h5-7,10-11,15H,8-9H2,1-4H3/t15-/m0/s1 |
| InChIKey | UHRZNPLJEPPUPT-HNNXBMFYSA-N |
| XLogP | 3.80 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|