C18H17FN4O4 — CID 9455314
(5-fluoro-2-nitrophenyl) 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 9455314) has the molecular formula C18H17FN4O4 and a molecular weight of 372.36 g/mol. Its IUPAC name is (5-fluoro-2-nitrophenyl) 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | (5-fluoro-2-nitrophenyl) 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 9455314 |
| Molecular Formula | C18H17FN4O4 |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (5-fluoro-2-nitrophenyl) 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1cc2nc(C)c(CCC(=O)Oc3cc(F)ccc3[N+](=O)[O-])c(C)n2n1 |
| InChI | InChI=1S/C18H17FN4O4/c1-10-8-17-20-11(2)14(12(3)22(17)21-10)5-7-18(24)27-16-9-13(19)4-6-15(16)23(25)26/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | BUJPLZRDPGNWBZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|