C25H28N4O5 — CID 46566229
methyl 3-[3,5-dimethyl-1-[4-[methyl-[1-(3-nitrophenyl)ethyl]carbamoyl]phenyl]pyrazol-4-yl]propanoate (PubChem CID 46566229) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is methyl 3-[3,5-dimethyl-1-[4-[methyl-[1-(3-nitrophenyl)ethyl]carbamoyl]phenyl]pyrazol-4-yl]propanoate.
| Compound Name | methyl 3-[3,5-dimethyl-1-[4-[methyl-[1-(3-nitrophenyl)ethyl]carbamoyl]phenyl]pyrazol-4-yl]propanoate |
|---|---|
| PubChem CID | 46566229 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | methyl 3-[3,5-dimethyl-1-[4-[methyl-[1-(3-nitrophenyl)ethyl]carbamoyl]phenyl]pyrazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1c(C)nn(-c2ccc(C(=O)N(C)C(C)c3cccc([N+](=O)[O-])c3)cc2)c1C |
| InChI | InChI=1S/C25H28N4O5/c1-16-23(13-14-24(30)34-5)18(3)28(26-16)21-11-9-19(10-12-21)25(31)27(4)17(2)20-7-6-8-22(15-20)29(32)33/h6-12,15,17H,13-14H2,1-5H3 |
| InChIKey | WXALFTKUTXSXLU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|