C22H23Cl2N5O — CID 90644230
5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-2-carbonitrile (PubChem CID 90644230) has the molecular formula C22H23Cl2N5O and a molecular weight of 444.37 g/mol. Its IUPAC name is 5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-2-carbonitrile.
| Compound Name | 5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 90644230 |
| Molecular Formula | C22H23Cl2N5O |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 5-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc2cc(OCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)ccn2n1 |
| InChI | InChI=1S/C22H23Cl2N5O/c23-20-4-3-5-21(22(20)24)28-11-9-27(10-12-28)7-1-2-13-30-19-6-8-29-18(15-19)14-17(16-25)26-29/h3-6,8,14-15H,1-2,7,9-13H2 |
| InChIKey | TXMVXDBYJCUQJD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|