C28H26FN3O4 — CID 90644853
(2Z)-2-[[4-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethoxy]phenyl]methylidene]-3-oxo-1-benzofuran-7-carboxamide (PubChem CID 90644853) has the molecular formula C28H26FN3O4 and a molecular weight of 487.53 g/mol. Its IUPAC name is (2Z)-2-[[4-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethoxy]phenyl]methylidene]-3-oxo-1-benzofuran-7-carboxamide.
| Compound Name | (2Z)-2-[[4-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethoxy]phenyl]methylidene]-3-oxo-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 90644853 |
| Molecular Formula | C28H26FN3O4 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | (2Z)-2-[[4-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethoxy]phenyl]methylidene]-3-oxo-1-benzofuran-7-carboxamide |
| SMILES | NC(=O)c1cccc2c1O/C(=C\c1ccc(OCCN3CCN(c4ccc(F)cc4)CC3)cc1)C2=O |
| InChI | InChI=1S/C28H26FN3O4/c29-20-6-8-21(9-7-20)32-14-12-31(13-15-32)16-17-35-22-10-4-19(5-11-22)18-25-26(33)23-2-1-3-24(28(30)34)27(23)36-25/h1-11,18H,12-17H2,(H2,30,34)/b25-18- |
| InChIKey | JJJZFUMXIICAON-BWAHOGKJSA-N |
| XLogP | 3.74 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|