C25H31ClN4O2S — CID 90645301
3-amino-N-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]butyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 90645301) has the molecular formula C25H31ClN4O2S and a molecular weight of 487.07 g/mol. Its IUPAC name is 3-amino-N-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]butyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]butyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90645301 |
| Molecular Formula | C25H31ClN4O2S |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3-amino-N-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]butyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C)c2c(N)c(C(=O)NCCCCN3CCC(O)(c4ccc(Cl)cc4)CC3)sc2n1 |
| InChI | InChI=1S/C25H31ClN4O2S/c1-16-15-17(2)29-24-20(16)21(27)22(33-24)23(31)28-11-3-4-12-30-13-9-25(32,10-14-30)18-5-7-19(26)8-6-18/h5-8,15,32H,3-4,9-14,27H2,1-2H3,(H,28,31) |
| InChIKey | MWEMZAUJQVTCGX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|