C19H26N2O2 — CID 90652685
(4-methoxy-3-prop-2-enylphenyl)-[(1S,5S)-6-methyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone (PubChem CID 90652685) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (4-methoxy-3-prop-2-enylphenyl)-[(1S,5S)-6-methyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone.
| Compound Name | (4-methoxy-3-prop-2-enylphenyl)-[(1S,5S)-6-methyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone |
|---|---|
| PubChem CID | 90652685 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (4-methoxy-3-prop-2-enylphenyl)-[(1S,5S)-6-methyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone |
| SMILES | C=CCc1cc(C(=O)N2C[C@H]3CC[C@@H](C2)N(C)C3)ccc1OC |
| InChI | InChI=1S/C19H26N2O2/c1-4-5-15-10-16(7-9-18(15)23-3)19(22)21-12-14-6-8-17(13-21)20(2)11-14/h4,7,9-10,14,17H,1,5-6,8,11-13H2,2-3H3/t14-,17-/m0/s1 |
| InChIKey | IAVLXJWBXDKIIG-YOEHRIQHSA-N |
| XLogP | 2.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|