About methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate
methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate (PubChem CID 90655092) has the molecular formula C21H20N2O5
and a molecular weight of 380.40 g/mol. Its IUPAC name is methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate |
| PubChem CID | 90655092 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate |
| SMILES | COC(=O)c1ccc(OC[C@](C)(O)C(=O)N2CCc3c(C#N)cccc32)cc1 |
| InChI | InChI=1S/C21H20N2O5/c1-21(26,13-28-16-8-6-14(7-9-16)19(24)27-2)20(25)23-11-10-17-15(12-22)4-3-5-18(17)23/h3-9,26H,10-11,13H2,1-2H3/t21-/m0/s1 |
| InChIKey | GCUMDODJOAYRHG-NRFANRHFSA-N |
| XLogP | 2.06 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate?
The IUPAC name of methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate (CID 90655092) is methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate.
What is the SMILES notation for methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate?
The canonical SMILES for methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate is COC(=O)c1ccc(OC[C@](C)(O)C(=O)N2CCc3c(C#N)cccc32)cc1.
What is the InChIKey of methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate?
The InChIKey is GCUMDODJOAYRHG-NRFANRHFSA-N. The full InChI is InChI=1S/C21H20N2O5/c1-21(26,13-28-16-8-6-14(7-9-16)19(24)27-2)20(25)23-11-10-17-15(12-22)4-3-5-18(17)23/h3-9,26H,10-11,13H2,1-2H3/t21-/m0/s1.
What are the key properties of methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate?
methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate has a molecular weight of 380.40 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2S)-3-(4-cyano-2,3-dihydroindol-1-yl)-2-hydroxy-2-methyl-3-oxopropoxy]benzoate is sourced from PubChem (CID 90655092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).