C34H38N8O — CID 90656058
4-tert-butyl-N-[2-methyl-3-[9-methyl-6-(4-piperazin-1-ylanilino)purin-2-yl]phenyl]benzamide (PubChem CID 90656058) has the molecular formula C34H38N8O and a molecular weight of 574.73 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-methyl-3-[9-methyl-6-(4-piperazin-1-ylanilino)purin-2-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-methyl-3-[9-methyl-6-(4-piperazin-1-ylanilino)purin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 90656058 |
| Molecular Formula | C34H38N8O |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | 4-tert-butyl-N-[2-methyl-3-[9-methyl-6-(4-piperazin-1-ylanilino)purin-2-yl]phenyl]benzamide |
| SMILES | Cc1c(NC(=O)c2ccc(C(C)(C)C)cc2)cccc1-c1nc(Nc2ccc(N3CCNCC3)cc2)c2ncn(C)c2n1 |
| InChI | InChI=1S/C34H38N8O/c1-22-27(7-6-8-28(22)38-33(43)23-9-11-24(12-10-23)34(2,3)4)30-39-31(29-32(40-30)41(5)21-36-29)37-25-13-15-26(16-14-25)42-19-17-35-18-20-42/h6-16,21,35H,17-20H2,1-5H3,(H,38,43)(H,37,39,40) |
| InChIKey | LWDDIVHRTHJDBZ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|