C22H16N2O4-2 — CID 90659054
3,6-dihydroxy-2,5-bis(1H-indol-3-yl)cyclohexa-1,4-diene-1,4-diolate (PubChem CID 90659054) has the molecular formula C22H16N2O4-2 and a molecular weight of 372.38 g/mol. Its IUPAC name is 3,6-dihydroxy-2,5-bis(1H-indol-3-yl)cyclohexa-1,4-diene-1,4-diolate.
| Compound Name | 3,6-dihydroxy-2,5-bis(1H-indol-3-yl)cyclohexa-1,4-diene-1,4-diolate |
|---|---|
| PubChem CID | 90659054 |
| Molecular Formula | C22H16N2O4-2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3,6-dihydroxy-2,5-bis(1H-indol-3-yl)cyclohexa-1,4-diene-1,4-diolate |
| SMILES | [O-]C1=C(c2c[nH]c3ccccc23)C(O)C([O-])=C(c2c[nH]c3ccccc23)C1O |
| InChI | InChI=1S/C22H18N2O4/c25-19-17(13-9-23-15-7-3-1-5-11(13)15)20(26)22(28)18(21(19)27)14-10-24-16-8-4-2-6-12(14)16/h1-10,19,22-28H/p-2 |
| InChIKey | MSBVTJUYXQZLBV-UHFFFAOYSA-L |
| XLogP | 1.23 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |