C14H17Cl2N3S — CID 90663672
2-methyl-13-thia-2,11-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8,10(14),11-pentaen-12-amine;dihydrochloride (PubChem CID 90663672) has the molecular formula C14H17Cl2N3S and a molecular weight of 330.28 g/mol. Its IUPAC name is 2-methyl-13-thia-2,11-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8,10(14),11-pentaen-12-amine;dihydrochloride.
| Compound Name | 2-methyl-13-thia-2,11-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8,10(14),11-pentaen-12-amine;dihydrochloride |
|---|---|
| PubChem CID | 90663672 |
| Molecular Formula | C14H17Cl2N3S |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 2-methyl-13-thia-2,11-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8,10(14),11-pentaen-12-amine;dihydrochloride |
| SMILES | CN1CCc2cccc3c2C1Cc1sc(N)nc1-3.Cl.Cl |
| InChI | InChI=1S/C14H15N3S.2ClH/c1-17-6-5-8-3-2-4-9-12(8)10(17)7-11-13(9)16-14(15)18-11;;/h2-4,10H,5-7H2,1H3,(H2,15,16);2*1H |
| InChIKey | PYFXYEKKYIQFOB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |