C27H41NO5 — CID 90665363
4,6-dimethoxy-1-[8-[(2S,5R,7S)-2-methyl-1,6-dioxaspiro[4.5]decan-7-yl]octyl]-3H-indol-2-one (PubChem CID 90665363) has the molecular formula C27H41NO5 and a molecular weight of 459.63 g/mol. Its IUPAC name is 4,6-dimethoxy-1-[8-[(2S,5R,7S)-2-methyl-1,6-dioxaspiro[4.5]decan-7-yl]octyl]-3H-indol-2-one.
| Compound Name | 4,6-dimethoxy-1-[8-[(2S,5R,7S)-2-methyl-1,6-dioxaspiro[4.5]decan-7-yl]octyl]-3H-indol-2-one |
|---|---|
| PubChem CID | 90665363 |
| Molecular Formula | C27H41NO5 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | 4,6-dimethoxy-1-[8-[(2S,5R,7S)-2-methyl-1,6-dioxaspiro[4.5]decan-7-yl]octyl]-3H-indol-2-one |
| SMILES | COc1cc(OC)c2c(c1)N(CCCCCCCC[C@H]1CCC[C@]3(CC[C@H](C)O3)O1)C(=O)C2 |
| InChI | InChI=1S/C27H41NO5/c1-20-13-15-27(32-20)14-10-12-21(33-27)11-8-6-4-5-7-9-16-28-24-17-22(30-2)18-25(31-3)23(24)19-26(28)29/h17-18,20-21H,4-16,19H2,1-3H3/t20-,21-,27+/m0/s1 |
| InChIKey | FWQRTBMMVKACQB-NOMHHCBYSA-N |
| XLogP | 5.79 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|