C34H34N4O2+2 — CID 90669815
4-[(E)-3-oxo-3-[(1-propylquinolin-1-ium-6-yl)amino]prop-1-enyl]-N-(1-propylquinolin-1-ium-6-yl)benzamide (PubChem CID 90669815) has the molecular formula C34H34N4O2+2 and a molecular weight of 530.67 g/mol. Its IUPAC name is 4-[(E)-3-oxo-3-[(1-propylquinolin-1-ium-6-yl)amino]prop-1-enyl]-N-(1-propylquinolin-1-ium-6-yl)benzamide.
| Compound Name | 4-[(E)-3-oxo-3-[(1-propylquinolin-1-ium-6-yl)amino]prop-1-enyl]-N-(1-propylquinolin-1-ium-6-yl)benzamide |
|---|---|
| PubChem CID | 90669815 |
| Molecular Formula | C34H34N4O2+2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 4-[(E)-3-oxo-3-[(1-propylquinolin-1-ium-6-yl)amino]prop-1-enyl]-N-(1-propylquinolin-1-ium-6-yl)benzamide |
| SMILES | CCC[n+]1cccc2cc(NC(=O)/C=C/c3ccc(C(=O)Nc4ccc5c(ccc[n+]5CCC)c4)cc3)ccc21 |
| InChI | InChI=1S/C34H32N4O2/c1-3-19-37-21-5-7-27-23-29(14-16-31(27)37)35-33(39)18-11-25-9-12-26(13-10-25)34(40)36-30-15-17-32-28(24-30)8-6-22-38(32)20-4-2/h5-18,21-24H,3-4,19-20H2,1-2H3/p+2/b18-11+ |
| InChIKey | DSKJCPFBOUMPPP-WOJGMQOQSA-P |
| XLogP | 6.29 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|