C16H24N3O8P — CID 90671507
[(2S)-2-[(2S,3S,4R,5R)-5-[4-amino-5-(3,3-dimethylbut-1-ynyl)-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]phosphonic acid (PubChem CID 90671507) has the molecular formula C16H24N3O8P and a molecular weight of 417.36 g/mol. Its IUPAC name is [(2S)-2-[(2S,3S,4R,5R)-5-[4-amino-5-(3,3-dimethylbut-1-ynyl)-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]phosphonic acid.
| Compound Name | [(2S)-2-[(2S,3S,4R,5R)-5-[4-amino-5-(3,3-dimethylbut-1-ynyl)-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]phosphonic acid |
|---|---|
| PubChem CID | 90671507 |
| Molecular Formula | C16H24N3O8P |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [(2S)-2-[(2S,3S,4R,5R)-5-[4-amino-5-(3,3-dimethylbut-1-ynyl)-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]-2-hydroxyethyl]phosphonic acid |
| SMILES | CC(C)(C)C#Cc1cn([C@@H]2O[C@H]([C@H](O)CP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)nc1N |
| InChI | InChI=1S/C16H24N3O8P/c1-16(2,3)5-4-8-6-19(15(23)18-13(8)17)14-11(22)10(21)12(27-14)9(20)7-28(24,25)26/h6,9-12,14,20-22H,7H2,1-3H3,(H2,17,18,23)(H2,24,25,26)/t9-,10+,11-,12-,14-/m1/s1 |
| InChIKey | XMJFZADWUGUOIE-CYRBOEJBSA-N |
| XLogP | -1.62 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|