C15H22ClNO — CID 90674178
3-(4-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;hydrochloride (PubChem CID 90674178) has the molecular formula C15H22ClNO and a molecular weight of 267.80 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;hydrochloride.
| Compound Name | 3-(4-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;hydrochloride |
|---|---|
| PubChem CID | 90674178 |
| Molecular Formula | C15H22ClNO |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 3-(4-methylphenyl)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazine;hydrochloride |
| SMILES | Cc1ccc(C2CN3CCCCC3CO2)cc1.Cl |
| InChI | InChI=1S/C15H21NO.ClH/c1-12-5-7-13(8-6-12)15-10-16-9-3-2-4-14(16)11-17-15;/h5-8,14-15H,2-4,9-11H2,1H3;1H |
| InChIKey | IXJWDXCLTZDYIT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |