C13H21N2O2+ — CID 90674286
7,8-dimethoxy-4,4-dimethyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-ium (PubChem CID 90674286) has the molecular formula C13H21N2O2+ and a molecular weight of 237.32 g/mol. Its IUPAC name is 7,8-dimethoxy-4,4-dimethyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-ium.
| Compound Name | 7,8-dimethoxy-4,4-dimethyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-ium |
|---|---|
| PubChem CID | 90674286 |
| Molecular Formula | C13H21N2O2+ |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 7,8-dimethoxy-4,4-dimethyl-1,2,3,5-tetrahydro-1,4-benzodiazepin-4-ium |
| SMILES | COc1cc2c(cc1OC)NCC[N+](C)(C)C2 |
| InChI | InChI=1S/C13H21N2O2/c1-15(2)6-5-14-11-8-13(17-4)12(16-3)7-10(11)9-15/h7-8,14H,5-6,9H2,1-4H3/q+1 |
| InChIKey | WHCISMWXESKLQW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|