C25H26ClNOS — CID 90675164
(1R,6R,8R)-6-thiophen-3-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol;hydrochloride (PubChem CID 90675164) has the molecular formula C25H26ClNOS and a molecular weight of 424.01 g/mol. Its IUPAC name is (1R,6R,8R)-6-thiophen-3-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol;hydrochloride.
| Compound Name | (1R,6R,8R)-6-thiophen-3-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol;hydrochloride |
|---|---|
| PubChem CID | 90675164 |
| Molecular Formula | C25H26ClNOS |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | (1R,6R,8R)-6-thiophen-3-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol;hydrochloride |
| SMILES | Cl.O[C@]1(c2ccsc2)CCN2C[C@@H]3c4ccccc4CCc4cccc(c43)[C@H]2C1 |
| InChI | InChI=1S/C25H25NOS.ClH/c27-25(19-10-13-28-16-19)11-12-26-15-22-20-6-2-1-4-17(20)8-9-18-5-3-7-21(24(18)22)23(26)14-25;/h1-7,10,13,16,22-23,27H,8-9,11-12,14-15H2;1H/t22-,23-,25-;/m1./s1 |
| InChIKey | PFQZVQGNEZMVQN-MNRXJBBMSA-N |
| XLogP | 5.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |