C28H30ClNO — CID 90675140
(1R,6R,8R)-6-(2-methylphenyl)-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol;hydrochloride (PubChem CID 90675140) has the molecular formula C28H30ClNO and a molecular weight of 432.01 g/mol. Its IUPAC name is (1R,6R,8R)-6-(2-methylphenyl)-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol;hydrochloride.
| Compound Name | (1R,6R,8R)-6-(2-methylphenyl)-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol;hydrochloride |
|---|---|
| PubChem CID | 90675140 |
| Molecular Formula | C28H30ClNO |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (1R,6R,8R)-6-(2-methylphenyl)-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16,18,20-hexaen-6-ol;hydrochloride |
| SMILES | Cc1ccccc1[C@@]1(O)CCN2C[C@@H]3c4ccccc4CCc4cccc(c43)[C@H]2C1.Cl |
| InChI | InChI=1S/C28H29NO.ClH/c1-19-7-2-5-12-25(19)28(30)15-16-29-18-24-22-10-4-3-8-20(22)13-14-21-9-6-11-23(27(21)24)26(29)17-28;/h2-12,24,26,30H,13-18H2,1H3;1H/t24-,26-,28-;/m1./s1 |
| InChIKey | AQNOSBHYTLLLIF-CQGRQOICSA-N |
| XLogP | 5.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |