(8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid

C21H36O2 — CID 90678568

IUPAC(8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid
SMILESCCCCC/C(C)=C\C/C=C\C/C=C\CCCCCCC(=O)O
InChIInChI=1S/C21H36O2/c1-3-4-14-17-20(2)18-15-12-10-8-6-5-7-9-11-13-16-19-21(22)23/h5-6,10,12,18H,3-4,7-9,11,13-17,19H2,1-2H3,(H,22,23)/b6-5-,12-10-,20-18-
InChIKeyBFFRRUQBVPOVOL-JRCNJNQNSA-N
MW320.52 g/mol
LogP6.83
Rot. Bonds15

About (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid

(8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid (PubChem CID 90678568) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid.

Molecular Properties

Compound Name(8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid
PubChem CID90678568
Molecular FormulaC21H36O2
Molecular Weight320.52 g/mol
Exact Mass320.27
IUPAC Name(8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid
SMILESCCCCC/C(C)=C\C/C=C\C/C=C\CCCCCCC(=O)O
InChIInChI=1S/C21H36O2/c1-3-4-14-17-20(2)18-15-12-10-8-6-5-7-9-11-13-16-19-21(22)23/h5-6,10,12,18H,3-4,7-9,11,13-17,19H2,1-2H3,(H,22,23)/b6-5-,12-10-,20-18-
InChIKeyBFFRRUQBVPOVOL-JRCNJNQNSA-N
XLogP6.83
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds15
Heavy Atoms23
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500320.52
LogP ≤ 56.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

tetracosa-9,12,15,18-tetraenoic acid
CID 75955148
(9E,12E)-(113C)octadeca-9,12-dienoic acid
CID 171042521
heptacosa-14,17-dienoic acid
CID 169276989
octacosa-10,13,16-trienoic acid
CID 169277248
(9Z,12Z,15Z)-henicosa-9,12,15-trienoic acid
CID 14647994
(23Z,26Z)-tetratriaconta-23,26-dienoic acid
CID 165284032
(10E,13E)-nonadeca-10,13-dienoic acid
CID 5312516
triaconta-18,21-dienoic acid
CID 169276961
octacosa-15,18-dienoic acid
CID 169277492
(7Z)-docosa-7,10,13,16-tetraenoic acid
CID 87131782
(7Z,13Z,16Z)-docosa-7,13,16-trienoic acid
CID 52922002
(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoic acid
CID 52921800

Frequently Asked Questions

What is the IUPAC name of (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid?
The IUPAC name of (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid (CID 90678568) is (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid.
What is the SMILES notation for (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid?
The canonical SMILES for (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid is CCCCC/C(C)=C\C/C=C\C/C=C\CCCCCCC(=O)O.
What is the InChIKey of (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid?
The InChIKey is BFFRRUQBVPOVOL-JRCNJNQNSA-N. The full InChI is InChI=1S/C21H36O2/c1-3-4-14-17-20(2)18-15-12-10-8-6-5-7-9-11-13-16-19-21(22)23/h5-6,10,12,18H,3-4,7-9,11,13-17,19H2,1-2H3,(H,22,23)/b6-5-,12-10-,20-18-.
What are the key properties of (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid?
(8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid has a molecular weight of 320.52 g/mol, XLogP of 6.83, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8Z,11Z,14Z)-15-methylicosa-8,11,14-trienoic acid is sourced from PubChem (CID 90678568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).