C17H24ClN5O — CID 90678694
4-[3-(dimethylamino)propylamino]-1,3-dimethyl-2H-pyrazolo[3,4-b]quinolin-7-one;hydrochloride (PubChem CID 90678694) has the molecular formula C17H24ClN5O and a molecular weight of 349.87 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylamino]-1,3-dimethyl-2H-pyrazolo[3,4-b]quinolin-7-one;hydrochloride.
| Compound Name | 4-[3-(dimethylamino)propylamino]-1,3-dimethyl-2H-pyrazolo[3,4-b]quinolin-7-one;hydrochloride |
|---|---|
| PubChem CID | 90678694 |
| Molecular Formula | C17H24ClN5O |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 4-[3-(dimethylamino)propylamino]-1,3-dimethyl-2H-pyrazolo[3,4-b]quinolin-7-one;hydrochloride |
| SMILES | Cc1[nH]n(C)c2nc3cc(=O)ccc3c(NCCCN(C)C)c12.Cl |
| InChI | InChI=1S/C17H23N5O.ClH/c1-11-15-16(18-8-5-9-21(2)3)13-7-6-12(23)10-14(13)19-17(15)22(4)20-11;/h6-7,10,18,20H,5,8-9H2,1-4H3;1H |
| InChIKey | CLWIBPUKUXBGMT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|