C22H27N3O4 — CID 90681304
4,5-bis[(3,4-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine (PubChem CID 90681304) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 4,5-bis[(3,4-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine.
| Compound Name | 4,5-bis[(3,4-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine |
|---|---|
| PubChem CID | 90681304 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4,5-bis[(3,4-dimethoxyphenyl)methyl]-1-methylimidazol-2-amine |
| SMILES | COc1ccc(Cc2nc(N)n(C)c2Cc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C22H27N3O4/c1-25-17(11-15-7-9-19(27-3)21(13-15)29-5)16(24-22(25)23)10-14-6-8-18(26-2)20(12-14)28-4/h6-9,12-13H,10-11H2,1-5H3,(H2,23,24) |
| InChIKey | JFNOFLXWVDJNHE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |