C32H24N2O4 — CID 90682145
3-[[5-[1-[(3-carboxyphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid (PubChem CID 90682145) has the molecular formula C32H24N2O4 and a molecular weight of 500.55 g/mol. Its IUPAC name is 3-[[5-[1-[(3-carboxyphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[5-[1-[(3-carboxyphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 90682145 |
| Molecular Formula | C32H24N2O4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 3-[[5-[1-[(3-carboxyphenyl)methyl]indol-6-yl]indol-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(Cn2ccc3cc(-c4ccc5ccn(Cc6cccc(C(=O)O)c6)c5c4)ccc32)c1 |
| InChI | InChI=1S/C32H24N2O4/c35-31(36)27-5-1-3-21(15-27)19-33-14-12-26-17-24(9-10-29(26)33)25-8-7-23-11-13-34(30(23)18-25)20-22-4-2-6-28(16-22)32(37)38/h1-18H,19-20H2,(H,35,36)(H,37,38) |
| InChIKey | MGHLKJRPDQKPOI-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |