C14H23N5O2S2 — CID 90690352
1-N'-(cyclopropanecarbothioyl)-1-N',3-N'-dimethyl-3-N'-(pyrrolidine-1-carbothioyl)propanedihydrazide (PubChem CID 90690352) has the molecular formula C14H23N5O2S2 and a molecular weight of 357.51 g/mol. Its IUPAC name is 1-N'-(cyclopropanecarbothioyl)-1-N',3-N'-dimethyl-3-N'-(pyrrolidine-1-carbothioyl)propanedihydrazide.
| Compound Name | 1-N'-(cyclopropanecarbothioyl)-1-N',3-N'-dimethyl-3-N'-(pyrrolidine-1-carbothioyl)propanedihydrazide |
|---|---|
| PubChem CID | 90690352 |
| Molecular Formula | C14H23N5O2S2 |
| Molecular Weight | 357.51 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-N'-(cyclopropanecarbothioyl)-1-N',3-N'-dimethyl-3-N'-(pyrrolidine-1-carbothioyl)propanedihydrazide |
| SMILES | CN(NC(=O)CC(=O)NN(C)C(=S)N1CCCC1)C(=S)C1CC1 |
| InChI | InChI=1S/C14H23N5O2S2/c1-17(13(22)10-5-6-10)15-11(20)9-12(21)16-18(2)14(23)19-7-3-4-8-19/h10H,3-9H2,1-2H3,(H,15,20)(H,16,21) |
| InChIKey | SDPWHXOWDYMRTQ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.51 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|