C15H13NO2 — CID 90690422
10-(trideuteriomethyl)-1H-acridine-9-carboxylic acid (PubChem CID 90690422) has the molecular formula C15H13NO2 and a molecular weight of 242.29 g/mol. Its IUPAC name is 10-(trideuteriomethyl)-1H-acridine-9-carboxylic acid.
| Compound Name | 10-(trideuteriomethyl)-1H-acridine-9-carboxylic acid |
|---|---|
| PubChem CID | 90690422 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 10-(trideuteriomethyl)-1H-acridine-9-carboxylic acid |
| SMILES | [2H]C([2H])([2H])N1C2=CC=CCC2=C(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C15H13NO2/c1-16-12-8-4-2-6-10(12)14(15(17)18)11-7-3-5-9-13(11)16/h2-6,8-9H,7H2,1H3,(H,17,18)/i1D3 |
| InChIKey | GQQVQAQSZCNEKW-FIBGUPNXSA-N |
| XLogP | 2.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |