C21H17NO2 — CID 91350654
(2,3,4,5,6-pentadeuteriophenyl) 10-(trideuteriomethyl)-1H-acridine-9-carboxylate (PubChem CID 91350654) has the molecular formula C21H17NO2 and a molecular weight of 323.42 g/mol. Its IUPAC name is (2,3,4,5,6-pentadeuteriophenyl) 10-(trideuteriomethyl)-1H-acridine-9-carboxylate.
| Compound Name | (2,3,4,5,6-pentadeuteriophenyl) 10-(trideuteriomethyl)-1H-acridine-9-carboxylate |
|---|---|
| PubChem CID | 91350654 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (2,3,4,5,6-pentadeuteriophenyl) 10-(trideuteriomethyl)-1H-acridine-9-carboxylate |
| SMILES | [2H]c1c([2H])c([2H])c(OC(=O)C2=C3CC=CC=C3N(C([2H])([2H])[2H])c3ccccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C21H17NO2/c1-22-18-13-7-5-11-16(18)20(17-12-6-8-14-19(17)22)21(23)24-15-9-3-2-4-10-15/h2-11,13-14H,12H2,1H3/i1D3,2D,3D,4D,9D,10D |
| InChIKey | DWDUODYMGICEML-APMHETRYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|