C14H13NO — CID 173211112
2-(1,3-dihydroisoindol-2-yl)cyclohexa-2,4-dien-1-one (PubChem CID 173211112) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(1,3-dihydroisoindol-2-yl)cyclohexa-2,4-dien-1-one.
| Compound Name | 2-(1,3-dihydroisoindol-2-yl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 173211112 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-yl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1CC=CC=C1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H13NO/c16-14-8-4-3-7-13(14)15-9-11-5-1-2-6-12(11)10-15/h1-7H,8-10H2 |
| InChIKey | FZXHBWCDMWIJAW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |