C31H40N4O9 — CID 90691336
but-3-enyl N-[[(5aS,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-5a,6a-dimethyl-8,10,11,12-tetraoxo-5,6,7,11a-tetrahydrotetracen-2-yl]methyl]carbamate (PubChem CID 90691336) has the molecular formula C31H40N4O9 and a molecular weight of 612.68 g/mol. Its IUPAC name is but-3-enyl N-[[(5aS,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-5a,6a-dimethyl-8,10,11,12-tetraoxo-5,6,7,11a-tetrahydrotetracen-2-yl]methyl]carbamate.
| Compound Name | but-3-enyl N-[[(5aS,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-5a,6a-dimethyl-8,10,11,12-tetraoxo-5,6,7,11a-tetrahydrotetracen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 90691336 |
| Molecular Formula | C31H40N4O9 |
| Molecular Weight | 612.68 g/mol |
| Exact Mass | 612.28 |
| IUPAC Name | but-3-enyl N-[[(5aS,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-5a,6a-dimethyl-8,10,11,12-tetraoxo-5,6,7,11a-tetrahydrotetracen-2-yl]methyl]carbamate |
| SMILES | C=CCCOC(=O)NCc1cc(N(C)C)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@]3(C)C[C@]1(C)C2 |
| InChI | InChI=1S/C31H40N4O9/c1-8-9-10-44-28(42)33-13-15-11-17(34(4)5)16-12-29(2)14-30(3)24(35(6)7)23(38)19(27(32)41)25(39)31(30,43)26(40)20(29)22(37)18(16)21(15)36/h8,11,19-20,24,36,43H,1,9-10,12-14H2,2-7H3,(H2,32,41)(H,33,42)/t19?,20?,24-,29+,30+,31-/m1/s1 |
| InChIKey | STWZGOLCHXUIJO-AVYKLXCYSA-N |
| XLogP | 0.52 |
| TPSA | 196.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.68 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|