C19H17F4NO3 — CID 90691785
(1S,7R,8R,10S)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol (PubChem CID 90691785) has the molecular formula C19H17F4NO3 and a molecular weight of 383.34 g/mol. Its IUPAC name is (1S,7R,8R,10S)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol.
| Compound Name | (1S,7R,8R,10S)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 90691785 |
| Molecular Formula | C19H17F4NO3 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | (1S,7R,8R,10S)-4-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1-c1ccc(OC(F)(F)C(F)F)cc1)[C@@H]1CC[C@H]2[C@H]2C[C@H]21 |
| InChI | InChI=1S/C19H17F4NO3/c20-18(21)19(22,23)27-9-3-1-8(2-4-9)24-16(25)14-10-5-6-11(13-7-12(10)13)15(14)17(24)26/h1-4,10-13,18,25-26H,5-7H2/t10-,11+,12+,13- |
| InChIKey | BOUCXMWHJJYALW-FNFFVJSTSA-N |
| XLogP | 4.74 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|