C18H15F4NO2 — CID 90955561
(1S,7R,8R,10S)-4-[2-fluoro-5-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol (PubChem CID 90955561) has the molecular formula C18H15F4NO2 and a molecular weight of 353.32 g/mol. Its IUPAC name is (1S,7R,8R,10S)-4-[2-fluoro-5-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol.
| Compound Name | (1S,7R,8R,10S)-4-[2-fluoro-5-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 90955561 |
| Molecular Formula | C18H15F4NO2 |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (1S,7R,8R,10S)-4-[2-fluoro-5-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodeca-2,5-diene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1-c1cc(C(F)(F)F)ccc1F)[C@@H]1CC[C@H]2[C@H]2C[C@H]21 |
| InChI | InChI=1S/C18H15F4NO2/c19-12-4-1-7(18(20,21)22)5-13(12)23-16(24)14-8-2-3-9(11-6-10(8)11)15(14)17(23)25/h1,4-5,8-11,24-25H,2-3,6H2/t8-,9+,10+,11- |
| InChIKey | GNNCRQSIUQTKTE-CKIJPRSSSA-N |
| XLogP | 4.66 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |