C27H28F3NO6 — CID 90902556
[4-[1-[1-(4-acetyloxyphenyl)-2,5-dihydroxy-4-methylpyrrol-3-yl]-3-(trifluoromethyl)pentyl]phenyl] acetate (PubChem CID 90902556) has the molecular formula C27H28F3NO6 and a molecular weight of 519.52 g/mol. Its IUPAC name is [4-[1-[1-(4-acetyloxyphenyl)-2,5-dihydroxy-4-methylpyrrol-3-yl]-3-(trifluoromethyl)pentyl]phenyl] acetate.
| Compound Name | [4-[1-[1-(4-acetyloxyphenyl)-2,5-dihydroxy-4-methylpyrrol-3-yl]-3-(trifluoromethyl)pentyl]phenyl] acetate |
|---|---|
| PubChem CID | 90902556 |
| Molecular Formula | C27H28F3NO6 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | [4-[1-[1-(4-acetyloxyphenyl)-2,5-dihydroxy-4-methylpyrrol-3-yl]-3-(trifluoromethyl)pentyl]phenyl] acetate |
| SMILES | CCC(CC(c1ccc(OC(C)=O)cc1)c1c(C)c(O)n(-c2ccc(OC(C)=O)cc2)c1O)C(F)(F)F |
| InChI | InChI=1S/C27H28F3NO6/c1-5-19(27(28,29)30)14-23(18-6-10-21(11-7-18)36-16(3)32)24-15(2)25(34)31(26(24)35)20-8-12-22(13-9-20)37-17(4)33/h6-13,19,23,34-35H,5,14H2,1-4H3 |
| InChIKey | CISRLOHVGLSVGM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|