C19H25N3O3S — CID 9069645
N-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 9069645) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9069645 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(N/N=C\[C@H]1CC=CCC1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H25N3O3S/c23-19(21-20-15-16-8-3-1-4-9-16)17-10-7-11-18(14-17)26(24,25)22-12-5-2-6-13-22/h1,3,7,10-11,14-16H,2,4-6,8-9,12-13H2,(H,21,23)/b20-15-/t16-/m0/s1 |
| InChIKey | VYYWZEZCVULAKH-UKEODDKASA-N |
| XLogP | 2.93 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|