C17H27N2+ — CID 90696908
3-(4-ethylidene-5-propylidene-1H-pyrrol-3-yl)-1-methyl-1-azoniabicyclo[2.2.2]octane (PubChem CID 90696908) has the molecular formula C17H27N2+ and a molecular weight of 259.42 g/mol. Its IUPAC name is 3-(4-ethylidene-5-propylidene-1H-pyrrol-3-yl)-1-methyl-1-azoniabicyclo[2.2.2]octane.
| Compound Name | 3-(4-ethylidene-5-propylidene-1H-pyrrol-3-yl)-1-methyl-1-azoniabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 90696908 |
| Molecular Formula | C17H27N2+ |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.22 |
| IUPAC Name | 3-(4-ethylidene-5-propylidene-1H-pyrrol-3-yl)-1-methyl-1-azoniabicyclo[2.2.2]octane |
| SMILES | CC=c1c(C2C[N+]3(C)CCC2CC3)c[nH]c1=CCC |
| InChI | InChI=1S/C17H27N2/c1-4-6-17-14(5-2)15(11-18-17)16-12-19(3)9-7-13(16)8-10-19/h5-6,11,13,16,18H,4,7-10,12H2,1-3H3/q+1 |
| InChIKey | NJNQAJDEJNNLBF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|