C33H25ClF3N3O2 — CID 90697035
N-[2-[4-(4-chlorophenyl)phenyl]-5-formamido-1,4-dimethylpyrrol-3-yl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 90697035) has the molecular formula C33H25ClF3N3O2 and a molecular weight of 588.03 g/mol. Its IUPAC name is N-[2-[4-(4-chlorophenyl)phenyl]-5-formamido-1,4-dimethylpyrrol-3-yl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[2-[4-(4-chlorophenyl)phenyl]-5-formamido-1,4-dimethylpyrrol-3-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 90697035 |
| Molecular Formula | C33H25ClF3N3O2 |
| Molecular Weight | 588.03 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | N-[2-[4-(4-chlorophenyl)phenyl]-5-formamido-1,4-dimethylpyrrol-3-yl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1c(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c(-c2ccc(-c3ccc(Cl)cc3)cc2)n(C)c1NC=O |
| InChI | InChI=1S/C33H25ClF3N3O2/c1-20-29(39-32(42)28-6-4-3-5-27(28)23-11-15-25(16-12-23)33(35,36)37)30(40(2)31(20)38-19-41)24-9-7-21(8-10-24)22-13-17-26(34)18-14-22/h3-19H,1-2H3,(H,38,41)(H,39,42) |
| InChIKey | LUBVSVMXCDKQGZ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.03 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|