C30H36ClF2N3O3Si — CID 90700425
2-[3-[(5-chloro-2,4-difluorophenyl)methyl]-8-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-5-yl]acetamide (PubChem CID 90700425) has the molecular formula C30H36ClF2N3O3Si and a molecular weight of 588.17 g/mol. Its IUPAC name is 2-[3-[(5-chloro-2,4-difluorophenyl)methyl]-8-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-5-yl]acetamide.
| Compound Name | 2-[3-[(5-chloro-2,4-difluorophenyl)methyl]-8-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-5-yl]acetamide |
|---|---|
| PubChem CID | 90700425 |
| Molecular Formula | C30H36ClF2N3O3Si |
| Molecular Weight | 588.17 g/mol |
| Exact Mass | 587.22 |
| IUPAC Name | 2-[3-[(5-chloro-2,4-difluorophenyl)methyl]-8-hydroxy-7-methyl-9-tri(propan-2-yl)silyloxypyrrolo[3,4-g]quinolin-5-yl]acetamide |
| SMILES | CC(C)[Si](Oc1c2ncc(Cc3cc(Cl)c(F)cc3F)cc2c(CC(N)=O)c2cn(C)c(O)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H36ClF2N3O3Si/c1-15(2)40(16(3)4,17(5)6)39-29-27-22(14-36(7)30(27)38)20(11-26(34)37)21-9-18(13-35-28(21)29)8-19-10-23(31)25(33)12-24(19)32/h9-10,12-17,38H,8,11H2,1-7H3,(H2,34,37) |
| InChIKey | HNRJLKCRWPAHDT-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.17 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|