C29H29F2N5O3 — CID 90701270
6-cyclopentyl-6-[2-[3,5-difluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione (PubChem CID 90701270) has the molecular formula C29H29F2N5O3 and a molecular weight of 533.58 g/mol. Its IUPAC name is 6-cyclopentyl-6-[2-[3,5-difluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-6-[2-[3,5-difluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 90701270 |
| Molecular Formula | C29H29F2N5O3 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 6-cyclopentyl-6-[2-[3,5-difluoro-4-(1-isocyanocyclopropyl)phenyl]ethyl]-3-[(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]oxane-2,4-dione |
| SMILES | [C-]#[N+]C1(c2c(F)cc(CCC3(C4CCCC4)CC(=O)C(Cc4nc5ncc(C)cn5n4)C(=O)O3)cc2F)CC1 |
| InChI | InChI=1S/C29H29F2N5O3/c1-17-15-33-27-34-24(35-36(27)16-17)13-20-23(37)14-29(39-26(20)38,19-5-3-4-6-19)8-7-18-11-21(30)25(22(31)12-18)28(32-2)9-10-28/h11-12,15-16,19-20H,3-10,13-14H2,1H3 |
| InChIKey | NOOMNGJRGVLEOZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 90.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|