About 7-methyl-3-oxooct-5-enal
7-methyl-3-oxooct-5-enal (PubChem CID 90701837) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 7-methyl-3-oxooct-5-enal.
Molecular Properties
| Compound Name | 7-methyl-3-oxooct-5-enal |
| PubChem CID | 90701837 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 7-methyl-3-oxooct-5-enal |
| SMILES | CC(C)C=CCC(=O)CC=O |
| InChI | InChI=1S/C9H14O2/c1-8(2)4-3-5-9(11)6-7-10/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | YWWBOTHZHWNVNA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-3-oxooct-5-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3-oxooct-5-enal?
The IUPAC name of 7-methyl-3-oxooct-5-enal (CID 90701837) is 7-methyl-3-oxooct-5-enal.
What is the SMILES notation for 7-methyl-3-oxooct-5-enal?
The canonical SMILES for 7-methyl-3-oxooct-5-enal is CC(C)C=CCC(=O)CC=O.
What is the InChIKey of 7-methyl-3-oxooct-5-enal?
The InChIKey is YWWBOTHZHWNVNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-8(2)4-3-5-9(11)6-7-10/h3-4,7-8H,5-6H2,1-2H3.
What are the key properties of 7-methyl-3-oxooct-5-enal?
7-methyl-3-oxooct-5-enal has a molecular weight of 154.21 g/mol, XLogP of 1.75, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3-oxooct-5-enal is sourced from PubChem (CID 90701837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).