About 4-chloro-3-oxopentanal
4-chloro-3-oxopentanal (PubChem CID 87595781) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is 4-chloro-3-oxopentanal.
Molecular Properties
| Compound Name | 4-chloro-3-oxopentanal |
| PubChem CID | 87595781 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 4-chloro-3-oxopentanal |
| SMILES | CC(Cl)C(=O)CC=O |
| InChI | InChI=1S/C5H7ClO2/c1-4(6)5(8)2-3-7/h3-4H,2H2,1H3 |
| InChIKey | PQDVAWWKYMHGRP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-oxopentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-oxopentanal?
The IUPAC name of 4-chloro-3-oxopentanal (CID 87595781) is 4-chloro-3-oxopentanal.
What is the SMILES notation for 4-chloro-3-oxopentanal?
The canonical SMILES for 4-chloro-3-oxopentanal is CC(Cl)C(=O)CC=O.
What is the InChIKey of 4-chloro-3-oxopentanal?
The InChIKey is PQDVAWWKYMHGRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO2/c1-4(6)5(8)2-3-7/h3-4H,2H2,1H3.
What are the key properties of 4-chloro-3-oxopentanal?
4-chloro-3-oxopentanal has a molecular weight of 134.56 g/mol, XLogP of 0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-oxopentanal is sourced from PubChem (CID 87595781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).