C22H23ClFN3O4 — CID 90702892
1-(4-chloro-5-methoxy-2-nitrophenyl)-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 90702892) has the molecular formula C22H23ClFN3O4 and a molecular weight of 447.89 g/mol. Its IUPAC name is 1-(4-chloro-5-methoxy-2-nitrophenyl)-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-(4-chloro-5-methoxy-2-nitrophenyl)-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 90702892 |
| Molecular Formula | C22H23ClFN3O4 |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 1-(4-chloro-5-methoxy-2-nitrophenyl)-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1cc(C(=O)C=CN2CCN(Cc3ccc(F)cc3)C[C@H]2C)c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C22H23ClFN3O4/c1-15-13-25(14-16-3-5-17(24)6-4-16)9-10-26(15)8-7-21(28)18-11-22(31-2)19(23)12-20(18)27(29)30/h3-8,11-12,15H,9-10,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | DQKNXVHQUAORGB-OAHLLOKOSA-N |
| XLogP | 4.30 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|