C23H27ClFN3O2 — CID 91319827
1-[2-amino-4-(2-chloroethoxy)phenyl]-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 91319827) has the molecular formula C23H27ClFN3O2 and a molecular weight of 431.94 g/mol. Its IUPAC name is 1-[2-amino-4-(2-chloroethoxy)phenyl]-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2-amino-4-(2-chloroethoxy)phenyl]-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 91319827 |
| Molecular Formula | C23H27ClFN3O2 |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-[2-amino-4-(2-chloroethoxy)phenyl]-3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)CCN1C=CC(=O)c1ccc(OCCCl)cc1N |
| InChI | InChI=1S/C23H27ClFN3O2/c1-17-15-27(16-18-2-4-19(25)5-3-18)11-12-28(17)10-8-23(29)21-7-6-20(14-22(21)26)30-13-9-24/h2-8,10,14,17H,9,11-13,15-16,26H2,1H3/t17-/m1/s1 |
| InChIKey | ISDXQXLZLLDWBP-QGZVFWFLSA-N |
| XLogP | 3.93 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|