C23H25ClFN3O — CID 69367507
(E)-1-(2-amino-4-chloro-5-methylphenyl)-3-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one (PubChem CID 69367507) has the molecular formula C23H25ClFN3O and a molecular weight of 413.92 g/mol. Its IUPAC name is (E)-1-(2-amino-4-chloro-5-methylphenyl)-3-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2-amino-4-chloro-5-methylphenyl)-3-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 69367507 |
| Molecular Formula | C23H25ClFN3O |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (E)-1-(2-amino-4-chloro-5-methylphenyl)-3-[3-[(4-fluorophenyl)methyl]-3,8-diazabicyclo[3.2.1]octan-8-yl]prop-2-en-1-one |
| SMILES | Cc1cc(C(=O)/C=C/N2C3CCC2CN(Cc2ccc(F)cc2)C3)c(N)cc1Cl |
| InChI | InChI=1S/C23H25ClFN3O/c1-15-10-20(22(26)11-21(15)24)23(29)8-9-28-18-6-7-19(28)14-27(13-18)12-16-2-4-17(25)5-3-16/h2-5,8-11,18-19H,6-7,12-14,26H2,1H3/b9-8+ |
| InChIKey | JTAGDPFFJPVOSF-CMDGGOBGSA-N |
| XLogP | 4.41 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|