C28H23BrN3O3S+ — CID 90703570
N-[3-[7-(2-bromoethoxy)-1-oxo-4H-isoquinolin-2-ium-2-yl]-4-methylphenyl]-2-thiophen-2-ylpyridine-4-carboxamide (PubChem CID 90703570) has the molecular formula C28H23BrN3O3S+ and a molecular weight of 561.48 g/mol. Its IUPAC name is N-[3-[7-(2-bromoethoxy)-1-oxo-4H-isoquinolin-2-ium-2-yl]-4-methylphenyl]-2-thiophen-2-ylpyridine-4-carboxamide.
| Compound Name | N-[3-[7-(2-bromoethoxy)-1-oxo-4H-isoquinolin-2-ium-2-yl]-4-methylphenyl]-2-thiophen-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 90703570 |
| Molecular Formula | C28H23BrN3O3S+ |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | N-[3-[7-(2-bromoethoxy)-1-oxo-4H-isoquinolin-2-ium-2-yl]-4-methylphenyl]-2-thiophen-2-ylpyridine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccnc(-c3cccs3)c2)cc1[N+]1=CCc2ccc(OCCBr)cc2C1=O |
| InChI | InChI=1S/C28H22BrN3O3S/c1-18-4-6-21(31-27(33)20-8-11-30-24(15-20)26-3-2-14-36-26)16-25(18)32-12-9-19-5-7-22(35-13-10-29)17-23(19)28(32)34/h2-8,11-12,14-17H,9-10,13H2,1H3/p+1 |
| InChIKey | VUVFJBLXYKDFGR-UHFFFAOYSA-O |
| XLogP | 6.26 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|