C17H13F3N2O4 — CID 90704649
7-methyl-5-nitro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol (PubChem CID 90704649) has the molecular formula C17H13F3N2O4 and a molecular weight of 366.30 g/mol. Its IUPAC name is 7-methyl-5-nitro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol.
| Compound Name | 7-methyl-5-nitro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 90704649 |
| Molecular Formula | C17H13F3N2O4 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 7-methyl-5-nitro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindol-1-ol |
| SMILES | Cc1cc([N+](=O)[O-])cc2cn(Cc3ccc(OC(F)(F)F)cc3)c(O)c12 |
| InChI | InChI=1S/C17H13F3N2O4/c1-10-6-13(22(24)25)7-12-9-21(16(23)15(10)12)8-11-2-4-14(5-3-11)26-17(18,19)20/h2-7,9,23H,8H2,1H3 |
| InChIKey | RTOUMYCTRCISAM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|