C20H23N2O2+ — CID 9070915
(4-ethylpiperazin-4-ium-1-yl)-(3-methylbenzo[g][1]benzofuran-2-yl)methanone (PubChem CID 9070915) has the molecular formula C20H23N2O2+ and a molecular weight of 323.42 g/mol. Its IUPAC name is (4-ethylpiperazin-4-ium-1-yl)-(3-methylbenzo[g][1]benzofuran-2-yl)methanone.
| Compound Name | (4-ethylpiperazin-4-ium-1-yl)-(3-methylbenzo[g][1]benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 9070915 |
| Molecular Formula | C20H23N2O2+ |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (4-ethylpiperazin-4-ium-1-yl)-(3-methylbenzo[g][1]benzofuran-2-yl)methanone |
| SMILES | CC[NH+]1CCN(C(=O)c2oc3c(ccc4ccccc43)c2C)CC1 |
| InChI | InChI=1S/C20H22N2O2/c1-3-21-10-12-22(13-11-21)20(23)18-14(2)16-9-8-15-6-4-5-7-17(15)19(16)24-18/h4-9H,3,10-13H2,1-2H3/p+1 |
| InChIKey | RSAPXXKHIOZCHG-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 37.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |