C31H38ClFIN3O4S — CID 90709511
3-[[(2R)-5-(3-chloro-5-fluorophenyl)-2-hydroxy-1-[(3-iodophenyl)methylamino]pentan-3-yl]sulfamoyl]-N,N-dipropylbenzamide (PubChem CID 90709511) has the molecular formula C31H38ClFIN3O4S and a molecular weight of 730.08 g/mol. Its IUPAC name is 3-[[(2R)-5-(3-chloro-5-fluorophenyl)-2-hydroxy-1-[(3-iodophenyl)methylamino]pentan-3-yl]sulfamoyl]-N,N-dipropylbenzamide.
| Compound Name | 3-[[(2R)-5-(3-chloro-5-fluorophenyl)-2-hydroxy-1-[(3-iodophenyl)methylamino]pentan-3-yl]sulfamoyl]-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 90709511 |
| Molecular Formula | C31H38ClFIN3O4S |
| Molecular Weight | 730.08 g/mol |
| Exact Mass | 729.13 |
| IUPAC Name | 3-[[(2R)-5-(3-chloro-5-fluorophenyl)-2-hydroxy-1-[(3-iodophenyl)methylamino]pentan-3-yl]sulfamoyl]-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(S(=O)(=O)NC(CCc2cc(F)cc(Cl)c2)[C@H](O)CNCc2cccc(I)c2)c1 |
| InChI | InChI=1S/C31H38ClFIN3O4S/c1-3-13-37(14-4-2)31(39)24-8-6-10-28(18-24)42(40,41)36-29(12-11-22-15-25(32)19-26(33)16-22)30(38)21-35-20-23-7-5-9-27(34)17-23/h5-10,15-19,29-30,35-36,38H,3-4,11-14,20-21H2,1-2H3/t29?,30-/m1/s1 |
| InChIKey | RWZKPETZPLOXNW-BDCODIICSA-N |
| XLogP | 5.78 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.08 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|