C21H23N3O2S — CID 90714130
O-[[3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate (PubChem CID 90714130) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is O-[[3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate.
| Compound Name | O-[[3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate |
|---|---|
| PubChem CID | 90714130 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | O-[[3-(4-methylphenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate |
| SMILES | Cc1ccc(C2=CC3(CCN(OC(=S)Nc4ccccc4)CC3)ON2)cc1 |
| InChI | InChI=1S/C21H23N3O2S/c1-16-7-9-17(10-8-16)19-15-21(26-23-19)11-13-24(14-12-21)25-20(27)22-18-5-3-2-4-6-18/h2-10,15,23H,11-14H2,1H3,(H,22,27) |
| InChIKey | DMHHDJCXCKCOOB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|