C5H4N4OS — CID 90715856
4-methoxy-[1,3]thiazolo[4,5-d]triazine (PubChem CID 90715856) has the molecular formula C5H4N4OS and a molecular weight of 168.18 g/mol. Its IUPAC name is 4-methoxy-[1,3]thiazolo[4,5-d]triazine.
| Compound Name | 4-methoxy-[1,3]thiazolo[4,5-d]triazine |
|---|---|
| PubChem CID | 90715856 |
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 4-methoxy-[1,3]thiazolo[4,5-d]triazine |
| SMILES | COc1nnnc2ncsc12 |
| InChI | InChI=1S/C5H4N4OS/c1-10-5-3-4(6-2-11-3)7-9-8-5/h2H,1H3 |
| InChIKey | GLRPIARCPFDQPQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |