C7H7N3O2S — CID 138040801
5,7-dimethoxy-[1,3]thiazolo[4,5-d]pyrimidine (PubChem CID 138040801) has the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. Its IUPAC name is 5,7-dimethoxy-[1,3]thiazolo[4,5-d]pyrimidine.
| Compound Name | 5,7-dimethoxy-[1,3]thiazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 138040801 |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 5,7-dimethoxy-[1,3]thiazolo[4,5-d]pyrimidine |
| SMILES | COc1nc(OC)c2scnc2n1 |
| InChI | InChI=1S/C7H7N3O2S/c1-11-6-4-5(8-3-13-4)9-7(10-6)12-2/h3H,1-2H3 |
| InChIKey | YZFRJPBLRHCSTA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |