C10H12N2O2S — CID 123646635
7-ethyl-2,4-dimethoxythieno[3,2-d]pyrimidine (PubChem CID 123646635) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 7-ethyl-2,4-dimethoxythieno[3,2-d]pyrimidine.
| Compound Name | 7-ethyl-2,4-dimethoxythieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 123646635 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 7-ethyl-2,4-dimethoxythieno[3,2-d]pyrimidine |
| SMILES | CCc1csc2c(OC)nc(OC)nc12 |
| InChI | InChI=1S/C10H12N2O2S/c1-4-6-5-15-8-7(6)11-10(14-3)12-9(8)13-2/h5H,4H2,1-3H3 |
| InChIKey | MVWBGRRMUZZEFP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |