C21H23N3O3 — CID 90719643
5-but-3-enyl-3-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)azepane-2,4,7-trione (PubChem CID 90719643) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 5-but-3-enyl-3-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)azepane-2,4,7-trione.
| Compound Name | 5-but-3-enyl-3-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)azepane-2,4,7-trione |
|---|---|
| PubChem CID | 90719643 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 5-but-3-enyl-3-(2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl)azepane-2,4,7-trione |
| SMILES | C=CCCC1CC(=O)NC(=O)C(C2NCCc3c2[nH]c2ccccc32)C1=O |
| InChI | InChI=1S/C21H23N3O3/c1-2-3-6-12-11-16(25)24-21(27)17(20(12)26)19-18-14(9-10-22-19)13-7-4-5-8-15(13)23-18/h2,4-5,7-8,12,17,19,22-23H,1,3,6,9-11H2,(H,24,25,27) |
| InChIKey | USIUKIOSWOPJBC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|