C25H21N3O — CID 98289203
(3S)-1-phenyl-3-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-3H-indol-2-one (PubChem CID 98289203) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is (3S)-1-phenyl-3-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-3H-indol-2-one.
| Compound Name | (3S)-1-phenyl-3-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-3H-indol-2-one |
|---|---|
| PubChem CID | 98289203 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (3S)-1-phenyl-3-[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]-3H-indol-2-one |
| SMILES | O=C1[C@H]([C@@H]2NCCc3c2[nH]c2ccccc32)c2ccccc2N1c1ccccc1 |
| InChI | InChI=1S/C25H21N3O/c29-25-22(19-11-5-7-13-21(19)28(25)16-8-2-1-3-9-16)24-23-18(14-15-26-24)17-10-4-6-12-20(17)27-23/h1-13,22,24,26-27H,14-15H2/t22-,24-/m0/s1 |
| InChIKey | FHGRMQONXLFYLC-UPVQGACJSA-N |
| XLogP | 4.82 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|